C8H13Cl2NO6 — CID 25174847
2,2-dichloro-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 25174847) has the molecular formula C8H13Cl2NO6 and a molecular weight of 290.10 g/mol. Its IUPAC name is 2,2-dichloro-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 25174847 |
| Molecular Formula | C8H13Cl2NO6 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2,2-dichloro-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | O=C[C@H](NC(=O)C(Cl)Cl)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H13Cl2NO6/c9-7(10)8(17)11-3(1-12)5(15)6(16)4(14)2-13/h1,3-7,13-16H,2H2,(H,11,17)/t3-,4+,5+,6+/m0/s1 |
| InChIKey | XYRIGVJOISMJKM-SLPGGIOYSA-N |
| XLogP | -2.45 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|