C9H17NO6S — CID 173061233
3-sulfanyl-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]propanamide (PubChem CID 173061233) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-sulfanyl-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]propanamide.
| Compound Name | 3-sulfanyl-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]propanamide |
|---|---|
| PubChem CID | 173061233 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-sulfanyl-N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]propanamide |
| SMILES | O=C[C@H](NC(=O)CCS)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO6S/c11-3-5(10-7(14)1-2-17)8(15)9(16)6(13)4-12/h3,5-6,8-9,12-13,15-17H,1-2,4H2,(H,10,14)/t5-,6+,8+,9+/m0/s1 |
| InChIKey | OAUICYOZHJIMNM-HIORRCEOSA-N |
| XLogP | -2.93 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|