C6H15NO5Si — CID 173425363
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(silylamino)hexanal (PubChem CID 173425363) has the molecular formula C6H15NO5Si and a molecular weight of 209.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(silylamino)hexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(silylamino)hexanal |
|---|---|
| PubChem CID | 173425363 |
| Molecular Formula | C6H15NO5Si |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-(silylamino)hexanal |
| SMILES | O=C[C@H](N[SiH3])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO5Si/c8-1-3(7-13)5(11)6(12)4(10)2-9/h1,3-7,9-12H,2H2,13H3/t3-,4+,5+,6+/m0/s1 |
| InChIKey | AMEYZDKKLNYYOZ-SLPGGIOYSA-N |
| XLogP | -4.50 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|