C6H12NO8S- — CID 171149399
N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamate (PubChem CID 171149399) has the molecular formula C6H12NO8S- and a molecular weight of 258.23 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamate.
| Compound Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamate |
|---|---|
| PubChem CID | 171149399 |
| Molecular Formula | C6H12NO8S- |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamate |
| SMILES | O=C[C@H](NS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO8S/c8-1-3(7-16(13,14)15)5(11)6(12)4(10)2-9/h1,3-7,9-12H,2H2,(H,13,14,15)/p-1/t3-,4+,5+,6+/m0/s1 |
| InChIKey | KZWHEHSUEBTKJM-SLPGGIOYSA-M |
| XLogP | -4.32 |
| TPSA | 167.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|