C6H15NO12S2 — CID 22818655
sulfuric acid;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid (PubChem CID 22818655) has the molecular formula C6H15NO12S2 and a molecular weight of 357.32 g/mol. Its IUPAC name is sulfuric acid;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid.
| Compound Name | sulfuric acid;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 22818655 |
| Molecular Formula | C6H15NO12S2 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | sulfuric acid;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid |
| SMILES | O=C[C@H](NS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C6H13NO8S.H2O4S/c8-1-3(7-16(13,14)15)5(11)6(12)4(10)2-9;1-5(2,3)4/h1,3-7,9-12H,2H2,(H,13,14,15);(H2,1,2,3,4)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | BQMYQFPRDWNIOJ-BTVCFUMJSA-N |
| XLogP | -4.63 |
| TPSA | 238.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|