C6H13NO11S2 — CID 87236956
(2S,3S,4R,5R)-1,2,3,4-tetrahydroxy-6-oxo-5-(sulfoamino)hexane-1-sulfonic acid (PubChem CID 87236956) has the molecular formula C6H13NO11S2 and a molecular weight of 339.30 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1,2,3,4-tetrahydroxy-6-oxo-5-(sulfoamino)hexane-1-sulfonic acid.
| Compound Name | (2S,3S,4R,5R)-1,2,3,4-tetrahydroxy-6-oxo-5-(sulfoamino)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 87236956 |
| Molecular Formula | C6H13NO11S2 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (2S,3S,4R,5R)-1,2,3,4-tetrahydroxy-6-oxo-5-(sulfoamino)hexane-1-sulfonic acid |
| SMILES | O=C[C@H](NS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H](O)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C6H13NO11S2/c8-1-2(7-20(16,17)18)3(9)4(10)5(11)6(12)19(13,14)15/h1-7,9-12H,(H,13,14,15)(H,16,17,18)/t2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | GIZGOKXWZGVMPS-QRXFDPRISA-N |
| XLogP | -4.76 |
| TPSA | 218.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|