C8H14NNaO9S — CID 138114310
sodium (5-acetamido-2,3,4-trihydroxy-6-oxohexyl) sulfate (PubChem CID 138114310) has the molecular formula C8H14NNaO9S and a molecular weight of 323.26 g/mol. Its IUPAC name is sodium (5-acetamido-2,3,4-trihydroxy-6-oxohexyl) sulfate.
| Compound Name | sodium (5-acetamido-2,3,4-trihydroxy-6-oxohexyl) sulfate |
|---|---|
| PubChem CID | 138114310 |
| Molecular Formula | C8H14NNaO9S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | sodium (5-acetamido-2,3,4-trihydroxy-6-oxohexyl) sulfate |
| SMILES | CC(=O)NC(C=O)C(O)C(O)C(O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H15NO9S.Na/c1-4(11)9-5(2-10)7(13)8(14)6(12)3-18-19(15,16)17;/h2,5-8,12-14H,3H2,1H3,(H,9,11)(H,15,16,17);/q;+1/p-1 |
| InChIKey | BLIIVRKKAXFSRM-UHFFFAOYSA-M |
| XLogP | -6.75 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|