C8H13NO6 — CID 175918337
N-[(2R,3R,4R,5S)-3,4,5-trihydroxy-1,6-dioxohexan-2-yl]acetamide (PubChem CID 175918337) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S)-3,4,5-trihydroxy-1,6-dioxohexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S)-3,4,5-trihydroxy-1,6-dioxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 175918337 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-[(2R,3R,4R,5S)-3,4,5-trihydroxy-1,6-dioxohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C8H13NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2-3,5-8,13-15H,1H3,(H,9,12)/t5-,6+,7+,8-/m0/s1 |
| InChIKey | ALYOJQJAWSZLPH-OSMVPFSASA-N |
| XLogP | -3.03 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|