C10H16N2O7 — CID 91474888
[(2R,3R,4S,5S)-2-acetamido-6-amino-4,5-dihydroxy-1,6-dioxohexan-3-yl] acetate (PubChem CID 91474888) has the molecular formula C10H16N2O7 and a molecular weight of 276.25 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-acetamido-6-amino-4,5-dihydroxy-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2-acetamido-6-amino-4,5-dihydroxy-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 91474888 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(2R,3R,4S,5S)-2-acetamido-6-amino-4,5-dihydroxy-1,6-dioxohexan-3-yl] acetate |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OC(C)=O)[C@@H](O)[C@H](O)C(N)=O |
| InChI | InChI=1S/C10H16N2O7/c1-4(14)12-6(3-13)9(19-5(2)15)7(16)8(17)10(11)18/h3,6-9,16-17H,1-2H3,(H2,11,18)(H,12,14)/t6-,7-,8-,9+/m0/s1 |
| InChIKey | IMQOJUYVCLCNIN-XSPKLOCKSA-N |
| XLogP | -3.17 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|