C12H21NO7 — CID 167008838
N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[(2R)-3-oxobutan-2-yl]oxyhexan-2-yl]acetamide (PubChem CID 167008838) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[(2R)-3-oxobutan-2-yl]oxyhexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[(2R)-3-oxobutan-2-yl]oxyhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 167008838 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[(2R)-3-oxobutan-2-yl]oxyhexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O[C@H](C)C(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H21NO7/c1-6(16)7(2)20-12(11(19)10(18)5-15)9(4-14)13-8(3)17/h4,7,9-12,15,18-19H,5H2,1-3H3,(H,13,17)/t7-,9+,10-,11-,12-/m1/s1 |
| InChIKey | XHNJGVKXRVMQIY-AWHZUTQYSA-N |
| XLogP | -2.23 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|