C20H32N4O13 — CID 150531123
2-[(2R)-2-[[(2S)-2-[[(2R)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoyl]amino]propanoyl]amino]-3-amino-3-oxopropyl]propanedioic acid (PubChem CID 150531123) has the molecular formula C20H32N4O13 and a molecular weight of 536.49 g/mol. Its IUPAC name is 2-[(2R)-2-[[(2S)-2-[[(2R)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoyl]amino]propanoyl]amino]-3-amino-3-oxopropyl]propanedioic acid.
| Compound Name | 2-[(2R)-2-[[(2S)-2-[[(2R)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoyl]amino]propanoyl]amino]-3-amino-3-oxopropyl]propanedioic acid |
|---|---|
| PubChem CID | 150531123 |
| Molecular Formula | C20H32N4O13 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[(2R)-2-[[(2S)-2-[[(2R)-2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoyl]amino]propanoyl]amino]-3-amino-3-oxopropyl]propanedioic acid |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C(=O)O)C(=O)O)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H32N4O13/c1-7(17(31)24-11(16(21)30)4-10(19(33)34)20(35)36)22-18(32)8(2)37-15(14(29)13(28)6-26)12(5-25)23-9(3)27/h5,7-8,10-15,26,28-29H,4,6H2,1-3H3,(H2,21,30)(H,22,32)(H,23,27)(H,24,31)(H,33,34)(H,35,36)/t7-,8+,11+,12-,13+,14+,15+/m0/s1 |
| InChIKey | IDWGELCAMKCIRY-DMPWITMRSA-N |
| XLogP | -5.17 |
| TPSA | 291.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|