C20H34N4O11 — CID 22823824
4-[2-[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid (PubChem CID 22823824) has the molecular formula C20H34N4O11 and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[2-[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[2-[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22823824 |
| Molecular Formula | C20H34N4O11 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[2-[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N(C)[C@@H](C=O)[C@@H](OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H34N4O11/c1-9(19(33)23-12(18(21)32)5-6-15(29)30)22-20(34)10(2)35-17(16(31)14(28)8-26)13(7-25)24(4)11(3)27/h7,9-10,12-14,16-17,26,28,31H,5-6,8H2,1-4H3,(H2,21,32)(H,22,34)(H,23,33)(H,29,30)/t9?,10?,12?,13-,14+,16+,17+/m0/s1 |
| InChIKey | JEILCGMRPFNYFX-GJYLCUPESA-N |
| XLogP | -4.14 |
| TPSA | 245.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|