C21H36N4O11 — CID 22823826
4-[[2-[[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoic acid (PubChem CID 22823826) has the molecular formula C21H36N4O11 and a molecular weight of 520.54 g/mol. Its IUPAC name is 4-[[2-[[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22823826 |
| Molecular Formula | C21H36N4O11 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 4-[[2-[[2-[(2R,3R,4R,5R)-2-[acetyl(methyl)amino]-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N(C)[C@@H](C=O)[C@@H](OCC(=O)NC(C(=O)NC(CCC(=O)O)C(N)=O)C(C)C)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H36N4O11/c1-10(2)17(21(35)23-12(20(22)34)5-6-16(31)32)24-15(30)9-36-19(18(33)14(29)8-27)13(7-26)25(4)11(3)28/h7,10,12-14,17-19,27,29,33H,5-6,8-9H2,1-4H3,(H2,22,34)(H,23,35)(H,24,30)(H,31,32)/t12?,13-,14+,17?,18+,19+/m0/s1 |
| InChIKey | JZDYOUAFTDOXJC-YGOBIIGWSA-N |
| XLogP | -3.89 |
| TPSA | 245.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|