C18H30N4O11 — CID 57047494
4-[3-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoic acid (PubChem CID 57047494) has the molecular formula C18H30N4O11 and a molecular weight of 478.46 g/mol. Its IUPAC name is 4-[3-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[3-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 57047494 |
| Molecular Formula | C18H30N4O11 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[3-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OCC(=O)NCCC(=O)NC(CCC(=O)O)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H30N4O11/c1-9(25)21-11(6-23)17(16(31)12(26)7-24)33-8-14(28)20-5-4-13(27)22-10(18(19)32)2-3-15(29)30/h6,10-12,16-17,24,26,31H,2-5,7-8H2,1H3,(H2,19,32)(H,20,28)(H,21,25)(H,22,27)(H,29,30)/t10?,11-,12+,16+,17+/m0/s1 |
| InChIKey | CREIJADJXNIXSZ-JQFCKIBMSA-N |
| XLogP | -4.87 |
| TPSA | 254.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|