C22H36N4O11 — CID 22823776
4-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-2-methyl-3-oxo-3-piperidin-1-ylpropanoyl]amino]-5-amino-5-oxopentanoic acid (PubChem CID 22823776) has the molecular formula C22H36N4O11 and a molecular weight of 532.55 g/mol. Its IUPAC name is 4-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-2-methyl-3-oxo-3-piperidin-1-ylpropanoyl]amino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-2-methyl-3-oxo-3-piperidin-1-ylpropanoyl]amino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22823776 |
| Molecular Formula | C22H36N4O11 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 4-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-2-methyl-3-oxo-3-piperidin-1-ylpropanoyl]amino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OC(C)(C(=O)NC(CCC(=O)O)C(N)=O)C(=O)N1CCCCC1)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H36N4O11/c1-12(29)24-14(10-27)18(17(33)15(30)11-28)37-22(2,21(36)26-8-4-3-5-9-26)20(35)25-13(19(23)34)6-7-16(31)32/h10,13-15,17-18,28,30,33H,3-9,11H2,1-2H3,(H2,23,34)(H,24,29)(H,25,35)(H,31,32)/t13?,14-,15+,17+,18+,22?/m0/s1 |
| InChIKey | BEWGOBJVMODYRE-VBDBOHMISA-N |
| XLogP | -3.60 |
| TPSA | 245.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|