C23H39N5O12 — CID 88602715
2-[[4-[[3-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-4-amino-2-methyl-4-oxobutanoyl]amino]-5-amino-5-oxopentanoyl]amino]pentanoic acid (PubChem CID 88602715) has the molecular formula C23H39N5O12 and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-[[4-[[3-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-4-amino-2-methyl-4-oxobutanoyl]amino]-5-amino-5-oxopentanoyl]amino]pentanoic acid.
| Compound Name | 2-[[4-[[3-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-4-amino-2-methyl-4-oxobutanoyl]amino]-5-amino-5-oxopentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 88602715 |
| Molecular Formula | C23H39N5O12 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[[4-[[3-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxy-4-amino-2-methyl-4-oxobutanoyl]amino]-5-amino-5-oxopentanoyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CCC(NC(=O)C(C)C(O[C@@H]([C@H](O)[C@H](O)CO)[C@H](C=O)NC(C)=O)C(N)=O)C(N)=O)C(=O)O |
| InChI | InChI=1S/C23H39N5O12/c1-4-5-13(23(38)39)27-16(33)7-6-12(20(24)35)28-22(37)10(2)18(21(25)36)40-19(17(34)15(32)9-30)14(8-29)26-11(3)31/h8,10,12-15,17-19,30,32,34H,4-7,9H2,1-3H3,(H2,24,35)(H2,25,36)(H,26,31)(H,27,33)(H,28,37)(H,38,39)/t10?,12?,13?,14-,15+,17+,18?,19+/m0/s1 |
| InChIKey | POLBQRYEYQKTBX-RTEMLANBSA-N |
| XLogP | -4.60 |
| TPSA | 297.77 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|