C26H45N5O12 — CID 54295333
2-[[5-amino-4-[2-[2-[(2R,3R,4R,5R)-2-(butanoylamino)-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-oxopentanoyl]amino]-3-methylbutanoic acid (PubChem CID 54295333) has the molecular formula C26H45N5O12 and a molecular weight of 619.67 g/mol. Its IUPAC name is 2-[[5-amino-4-[2-[2-[(2R,3R,4R,5R)-2-(butanoylamino)-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-oxopentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[5-amino-4-[2-[2-[(2R,3R,4R,5R)-2-(butanoylamino)-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-oxopentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54295333 |
| Molecular Formula | C26H45N5O12 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | 2-[[5-amino-4-[2-[2-[(2R,3R,4R,5R)-2-(butanoylamino)-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]-5-oxopentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCCC(=O)N[C@@H](C=O)[C@@H](OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(C(=O)O)C(C)C)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C26H45N5O12/c1-6-7-18(35)29-16(10-32)22(21(37)17(34)11-33)43-14(5)25(40)28-13(4)24(39)30-15(23(27)38)8-9-19(36)31-20(12(2)3)26(41)42/h10,12-17,20-22,33-34,37H,6-9,11H2,1-5H3,(H2,27,38)(H,28,40)(H,29,35)(H,30,39)(H,31,36)(H,41,42)/t13?,14?,15?,16-,17+,20?,21+,22+/m0/s1 |
| InChIKey | SAJZAHJSOCDAFP-HVJVRMPASA-N |
| XLogP | -3.56 |
| TPSA | 283.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|