C26H42N2O7 — CID 90000341
N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[1-oxo-1-(1-phenylpropan-2-ylamino)propan-2-yl]oxyhexan-2-yl]octanamide (PubChem CID 90000341) has the molecular formula C26H42N2O7 and a molecular weight of 494.63 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[1-oxo-1-(1-phenylpropan-2-ylamino)propan-2-yl]oxyhexan-2-yl]octanamide.
| Compound Name | N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[1-oxo-1-(1-phenylpropan-2-ylamino)propan-2-yl]oxyhexan-2-yl]octanamide |
|---|---|
| PubChem CID | 90000341 |
| Molecular Formula | C26H42N2O7 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | N-[(2R,3R,4R,5R)-4,5,6-trihydroxy-1-oxo-3-[1-oxo-1-(1-phenylpropan-2-ylamino)propan-2-yl]oxyhexan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@@H](C=O)[C@@H](OC(C)C(=O)NC(C)Cc1ccccc1)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C26H42N2O7/c1-4-5-6-7-11-14-23(32)28-21(16-29)25(24(33)22(31)17-30)35-19(3)26(34)27-18(2)15-20-12-9-8-10-13-20/h8-10,12-13,16,18-19,21-22,24-25,30-31,33H,4-7,11,14-15,17H2,1-3H3,(H,27,34)(H,28,32)/t18?,19?,21-,22+,24+,25+/m0/s1 |
| InChIKey | WITANICHYMCRSD-VADZXNRHSA-N |
| XLogP | 1.27 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|