C20H33NO — CID 98131356
N-[(2S)-4-phenylbutan-2-yl]decanamide (PubChem CID 98131356) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is N-[(2S)-4-phenylbutan-2-yl]decanamide.
| Compound Name | N-[(2S)-4-phenylbutan-2-yl]decanamide |
|---|---|
| PubChem CID | 98131356 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | N-[(2S)-4-phenylbutan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H33NO/c1-3-4-5-6-7-8-12-15-20(22)21-18(2)16-17-19-13-10-9-11-14-19/h9-11,13-14,18H,3-8,12,15-17H2,1-2H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | QUHAEVREYFTQBP-SFHVURJKSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|