C30H54N2O2 — CID 160985746
4-phenyl-N-propan-2-ylbutanamide;N-propan-2-yltetradecanamide (PubChem CID 160985746) has the molecular formula C30H54N2O2 and a molecular weight of 474.77 g/mol. Its IUPAC name is 4-phenyl-N-propan-2-ylbutanamide;N-propan-2-yltetradecanamide.
| Compound Name | 4-phenyl-N-propan-2-ylbutanamide;N-propan-2-yltetradecanamide |
|---|---|
| PubChem CID | 160985746 |
| Molecular Formula | C30H54N2O2 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.42 |
| IUPAC Name | 4-phenyl-N-propan-2-ylbutanamide;N-propan-2-yltetradecanamide |
| SMILES | CC(C)NC(=O)CCCc1ccccc1.CCCCCCCCCCCCCC(=O)NC(C)C |
| InChI | InChI=1S/C17H35NO.C13H19NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(19)18-16(2)3;1-11(2)14-13(15)10-6-9-12-7-4-3-5-8-12/h16H,4-15H2,1-3H3,(H,18,19);3-5,7-8,11H,6,9-10H2,1-2H3,(H,14,15) |
| InChIKey | TTYJDYXEFPLFPR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|