C23H39N5O12 — CID 54114945
2-[[4-[2-[[(2R,3R,4R,5R)-5-acetamido-1,2,3-trihydroxy-6-oxoheptan-4-yl]oxycarbonylamino]propanoylamino]-5-amino-5-oxopentanoyl]amino]pentanoic acid (PubChem CID 54114945) has the molecular formula C23H39N5O12 and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-[[4-[2-[[(2R,3R,4R,5R)-5-acetamido-1,2,3-trihydroxy-6-oxoheptan-4-yl]oxycarbonylamino]propanoylamino]-5-amino-5-oxopentanoyl]amino]pentanoic acid.
| Compound Name | 2-[[4-[2-[[(2R,3R,4R,5R)-5-acetamido-1,2,3-trihydroxy-6-oxoheptan-4-yl]oxycarbonylamino]propanoylamino]-5-amino-5-oxopentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54114945 |
| Molecular Formula | C23H39N5O12 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[[4-[2-[[(2R,3R,4R,5R)-5-acetamido-1,2,3-trihydroxy-6-oxoheptan-4-yl]oxycarbonylamino]propanoylamino]-5-amino-5-oxopentanoyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CCC(NC(=O)C(C)NC(=O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](NC(C)=O)C(C)=O)C(N)=O)C(=O)O |
| InChI | InChI=1S/C23H39N5O12/c1-5-6-14(22(37)38)27-16(33)8-7-13(20(24)35)28-21(36)10(2)25-23(39)40-19(18(34)15(32)9-29)17(11(3)30)26-12(4)31/h10,13-15,17-19,29,32,34H,5-9H2,1-4H3,(H2,24,35)(H,25,39)(H,26,31)(H,27,33)(H,28,36)(H,37,38)/t10?,13?,14?,15-,17+,18-,19-/m1/s1 |
| InChIKey | NJRQNABPXMXVPW-DGXBDKDTSA-N |
| XLogP | -3.60 |
| TPSA | 283.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |