C16H29N5O6 — CID 88666635
(2S)-2-[[(4R)-4-[[(2S)-2-acetamidopropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-6-aminohexanoic acid (PubChem CID 88666635) has the molecular formula C16H29N5O6 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-2-[[(4R)-4-[[(2S)-2-acetamidopropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-6-aminohexanoic acid.
| Compound Name | (2S)-2-[[(4R)-4-[[(2S)-2-acetamidopropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-6-aminohexanoic acid |
|---|---|
| PubChem CID | 88666635 |
| Molecular Formula | C16H29N5O6 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (2S)-2-[[(4R)-4-[[(2S)-2-acetamidopropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-6-aminohexanoic acid |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@H](CCC(=O)N[C@@H](CCCCN)C(=O)O)C(N)=O |
| InChI | InChI=1S/C16H29N5O6/c1-9(19-10(2)22)15(25)21-11(14(18)24)6-7-13(23)20-12(16(26)27)5-3-4-8-17/h9,11-12H,3-8,17H2,1-2H3,(H2,18,24)(H,19,22)(H,20,23)(H,21,25)(H,26,27)/t9-,11+,12-/m0/s1 |
| InChIKey | NDGLGQFFLPVULE-WCQGTBRESA-N |
| XLogP | -2.04 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|