C16H29N5O7 — CID 18489077
2-[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 18489077) has the molecular formula C16H29N5O7 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18489077 |
| Molecular Formula | C16H29N5O7 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)CN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N5O7/c1-9(14(25)21-11(16(27)28)5-6-13(23)24)19-15(26)10(4-2-3-7-17)20-12(22)8-18/h9-11H,2-8,17-18H2,1H3,(H,19,26)(H,20,22)(H,21,25)(H,23,24)(H,27,28) |
| InChIKey | MWKCORXJUHPJKF-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|