C15H26N4O7 — CID 18492238
2-[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 18492238) has the molecular formula C15H26N4O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18492238 |
| Molecular Formula | C15H26N4O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(NC(=O)CN)C(C)C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N4O7/c1-7(2)12(19-10(20)6-16)14(24)17-8(3)13(23)18-9(15(25)26)4-5-11(21)22/h7-9,12H,4-6,16H2,1-3H3,(H,17,24)(H,18,23)(H,19,20)(H,21,22)(H,25,26) |
| InChIKey | HBAXEEAWAWNHTK-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |