C8H18ClN3O2 — CID 74765100
2-acetamido-6-aminohexanamide;hydrochloride (PubChem CID 74765100) has the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. Its IUPAC name is 2-acetamido-6-aminohexanamide;hydrochloride.
| Compound Name | 2-acetamido-6-aminohexanamide;hydrochloride |
|---|---|
| PubChem CID | 74765100 |
| Molecular Formula | C8H18ClN3O2 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-acetamido-6-aminohexanamide;hydrochloride |
| SMILES | CC(=O)NC(CCCCN)C(N)=O.Cl |
| InChI | InChI=1S/C8H17N3O2.ClH/c1-6(12)11-7(8(10)13)4-2-3-5-9;/h7H,2-5,9H2,1H3,(H2,10,13)(H,11,12);1H |
| InChIKey | LPMFSHANWDFTBS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|