C12H24N4O4 — CID 138591531
(2S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-6-aminohexanamide (PubChem CID 138591531) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-6-aminohexanamide.
| Compound Name | (2S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-6-aminohexanamide |
|---|---|
| PubChem CID | 138591531 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-acetamido-3-hydroxybutanoyl]amino]-6-aminohexanamide |
| SMILES | CC(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(N)=O)[C@H](C)O |
| InChI | InChI=1S/C12H24N4O4/c1-7(17)10(15-8(2)18)12(20)16-9(11(14)19)5-3-4-6-13/h7,9-10,17H,3-6,13H2,1-2H3,(H2,14,19)(H,15,18)(H,16,20)/t7-,9-,10-/m0/s1 |
| InChIKey | IZUAIGPIJGKFIH-HGNGGELXSA-N |
| XLogP | -2.03 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|