C17H33N5O7 — CID 18239260
6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18239260) has the molecular formula C17H33N5O7 and a molecular weight of 419.48 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18239260 |
| Molecular Formula | C17H33N5O7 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(C(=O)NC(CCCCN)C(=O)O)C(C)O)C(C)O |
| InChI | InChI=1S/C17H33N5O7/c1-8(19)14(25)21-13(10(3)24)16(27)22-12(9(2)23)15(26)20-11(17(28)29)6-4-5-7-18/h8-13,23-24H,4-7,18-19H2,1-3H3,(H,20,26)(H,21,25)(H,22,27)(H,28,29) |
| InChIKey | CUQWSMATAWRKGB-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|