C15H30N4O4 — CID 145453607
(2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 145453607) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145453607 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C15H30N4O4/c1-4-9(2)12(19-13(20)10(3)17)14(21)18-11(15(22)23)7-5-6-8-16/h9-12H,4-8,16-17H2,1-3H3,(H,18,21)(H,19,20)(H,22,23)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | RZZMZYZXNJRPOJ-BJDJZHNGSA-N |
| XLogP | -0.44 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|