C19H36N6O8 — CID 18483485
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18483485) has the molecular formula C19H36N6O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18483485 |
| Molecular Formula | C19H36N6O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCC(N)=O)C(=O)NC(C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C19H36N6O8/c1-9(26)14(17(30)23-12(19(32)33)5-3-4-8-20)25-18(31)15(10(2)27)24-16(29)11(21)6-7-13(22)28/h9-12,14-15,26-27H,3-8,20-21H2,1-2H3,(H2,22,28)(H,23,30)(H,24,29)(H,25,31)(H,32,33) |
| InChIKey | RTTGOUUOEDEJMB-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|