C21H41N7O7 — CID 18305017
6-amino-2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18305017) has the molecular formula C21H41N7O7 and a molecular weight of 503.60 g/mol. Its IUPAC name is 6-amino-2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18305017 |
| Molecular Formula | C21H41N7O7 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 6-amino-2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H41N7O7/c1-12(29)17(20(33)27-15(21(34)35)7-3-5-11-23)28-19(32)14(8-9-16(25)30)26-18(31)13(24)6-2-4-10-22/h12-15,17,29H,2-11,22-24H2,1H3,(H2,25,30)(H,26,31)(H,27,33)(H,28,32)(H,34,35) |
| InChIKey | MIIJDGKJXAZZFL-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 265.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|