C18H34N6O7 — CID 18305006
2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid (PubChem CID 18305006) has the molecular formula C18H34N6O7 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18305006 |
| Molecular Formula | C18H34N6O7 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCCN)C(C)O)C(=O)O |
| InChI | InChI=1S/C18H34N6O7/c1-9(18(30)31)22-17(29)14(10(2)25)24-16(28)12(6-7-13(21)26)23-15(27)11(20)5-3-4-8-19/h9-12,14,25H,3-8,19-20H2,1-2H3,(H2,21,26)(H,22,29)(H,23,27)(H,24,28)(H,30,31) |
| InChIKey | CSRVBHMGMBNVML-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|