C25H53N9O4 — CID 89335377
6-amino-2-[[6-amino-2-[[6-amino-2-[[6-amino-2-(methylamino)hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]hexanamide (PubChem CID 89335377) has the molecular formula C25H53N9O4 and a molecular weight of 543.76 g/mol. Its IUPAC name is 6-amino-2-[[6-amino-2-[[6-amino-2-[[6-amino-2-(methylamino)hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]hexanamide.
| Compound Name | 6-amino-2-[[6-amino-2-[[6-amino-2-[[6-amino-2-(methylamino)hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 89335377 |
| Molecular Formula | C25H53N9O4 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.42 |
| IUPAC Name | 6-amino-2-[[6-amino-2-[[6-amino-2-[[6-amino-2-(methylamino)hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]hexanamide |
| SMILES | CNC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(N)=O |
| InChI | InChI=1S/C25H53N9O4/c1-31-19(11-3-7-15-27)23(36)33-21(13-5-9-17-29)25(38)34-20(12-4-8-16-28)24(37)32-18(22(30)35)10-2-6-14-26/h18-21,31H,2-17,26-29H2,1H3,(H2,30,35)(H,32,37)(H,33,36)(H,34,38) |
| InChIKey | LVJBLHKOWVSRHF-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 246.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|