C14H30N4O2 — CID 178053261
6-amino-N-[6-amino-1-(methylamino)-1-oxohexan-2-yl]-2-methylhexanamide (PubChem CID 178053261) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 6-amino-N-[6-amino-1-(methylamino)-1-oxohexan-2-yl]-2-methylhexanamide.
| Compound Name | 6-amino-N-[6-amino-1-(methylamino)-1-oxohexan-2-yl]-2-methylhexanamide |
|---|---|
| PubChem CID | 178053261 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 6-amino-N-[6-amino-1-(methylamino)-1-oxohexan-2-yl]-2-methylhexanamide |
| SMILES | CNC(=O)C(CCCCN)NC(=O)C(C)CCCCN |
| InChI | InChI=1S/C14H30N4O2/c1-11(7-3-5-9-15)13(19)18-12(14(20)17-2)8-4-6-10-16/h11-12H,3-10,15-16H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | TUXDAIYKYDVMHP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|