C10H20N6O2 — CID 146234106
(2S)-6-amino-2-(3-azidopropanoylamino)-N-methylhexanamide (PubChem CID 146234106) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2S)-6-amino-2-(3-azidopropanoylamino)-N-methylhexanamide.
| Compound Name | (2S)-6-amino-2-(3-azidopropanoylamino)-N-methylhexanamide |
|---|---|
| PubChem CID | 146234106 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2S)-6-amino-2-(3-azidopropanoylamino)-N-methylhexanamide |
| SMILES | CNC(=O)[C@H](CCCCN)NC(=O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H20N6O2/c1-13-10(18)8(4-2-3-6-11)15-9(17)5-7-14-16-12/h8H,2-7,11H2,1H3,(H,13,18)(H,15,17)/t8-/m0/s1 |
| InChIKey | DCPOAVLDZMRHIN-QMMMGPOBSA-N |
| XLogP | 0.05 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|