C17H35N9O3 — CID 166987114
2-(butanoylamino)-5-(diaminomethylideneamino)-N-[5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]pentanamide (PubChem CID 166987114) has the molecular formula C17H35N9O3 and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-(butanoylamino)-5-(diaminomethylideneamino)-N-[5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]pentanamide.
| Compound Name | 2-(butanoylamino)-5-(diaminomethylideneamino)-N-[5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 166987114 |
| Molecular Formula | C17H35N9O3 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 2-(butanoylamino)-5-(diaminomethylideneamino)-N-[5-(diaminomethylideneamino)-1-(methylamino)-1-oxopentan-2-yl]pentanamide |
| SMILES | CCCC(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC |
| InChI | InChI=1S/C17H35N9O3/c1-3-6-13(27)25-12(8-5-10-24-17(20)21)15(29)26-11(14(28)22-2)7-4-9-23-16(18)19/h11-12H,3-10H2,1-2H3,(H,22,28)(H,25,27)(H,26,29)(H4,18,19,23)(H4,20,21,24) |
| InChIKey | QYPUTZPYWZJBKS-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|