C9H17N5O4 — CID 156538701
(2R)-6-amino-2-(2-azidoethoxycarbonylamino)hexanoic acid (PubChem CID 156538701) has the molecular formula C9H17N5O4 and a molecular weight of 259.27 g/mol. Its IUPAC name is (2R)-6-amino-2-(2-azidoethoxycarbonylamino)hexanoic acid.
| Compound Name | (2R)-6-amino-2-(2-azidoethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 156538701 |
| Molecular Formula | C9H17N5O4 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (2R)-6-amino-2-(2-azidoethoxycarbonylamino)hexanoic acid |
| SMILES | [N-]=[N+]=NCCOC(=O)N[C@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C9H17N5O4/c10-4-2-1-3-7(8(15)16)13-9(17)18-6-5-12-14-11/h7H,1-6,10H2,(H,13,17)(H,15,16)/t7-/m1/s1 |
| InChIKey | YFKPJUHXCHQTCQ-SSDOTTSWSA-N |
| XLogP | 0.61 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|