C31H62N2O4 — CID 175393915
6-amino-2-[(6-methyl-5-nonyltetradecoxy)carbonylamino]hexanoic acid (PubChem CID 175393915) has the molecular formula C31H62N2O4 and a molecular weight of 526.85 g/mol. Its IUPAC name is 6-amino-2-[(6-methyl-5-nonyltetradecoxy)carbonylamino]hexanoic acid.
| Compound Name | 6-amino-2-[(6-methyl-5-nonyltetradecoxy)carbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175393915 |
| Molecular Formula | C31H62N2O4 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.47 |
| IUPAC Name | 6-amino-2-[(6-methyl-5-nonyltetradecoxy)carbonylamino]hexanoic acid |
| SMILES | CCCCCCCCCC(CCCCOC(=O)NC(CCCCN)C(=O)O)C(C)CCCCCCCC |
| InChI | InChI=1S/C31H62N2O4/c1-4-6-8-10-12-14-16-22-28(27(3)21-15-13-11-9-7-5-2)23-18-20-26-37-31(36)33-29(30(34)35)24-17-19-25-32/h27-29H,4-26,32H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | LAFFXNCYULHXJI-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|