C10H21N3O7 — CID 89081480
6-amino-2-[3-(dihydroxyamino)oxypropoxycarbonylamino]hexanoic acid (PubChem CID 89081480) has the molecular formula C10H21N3O7 and a molecular weight of 295.29 g/mol. Its IUPAC name is 6-amino-2-[3-(dihydroxyamino)oxypropoxycarbonylamino]hexanoic acid.
| Compound Name | 6-amino-2-[3-(dihydroxyamino)oxypropoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 89081480 |
| Molecular Formula | C10H21N3O7 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 6-amino-2-[3-(dihydroxyamino)oxypropoxycarbonylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)OCCCON(O)O)C(=O)O |
| InChI | InChI=1S/C10H21N3O7/c11-5-2-1-4-8(9(14)15)12-10(16)19-6-3-7-20-13(17)18/h8,17-18H,1-7,11H2,(H,12,16)(H,14,15) |
| InChIKey | DLJAQPJIWXQITP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|