C12H22N2O8 — CID 177147686
2,6-bis(2-hydroxyethoxycarbonylamino)hexanoic acid (PubChem CID 177147686) has the molecular formula C12H22N2O8 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,6-bis(2-hydroxyethoxycarbonylamino)hexanoic acid.
| Compound Name | 2,6-bis(2-hydroxyethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 177147686 |
| Molecular Formula | C12H22N2O8 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2,6-bis(2-hydroxyethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(NCCCCC(NC(=O)OCCO)C(=O)O)OCCO |
| InChI | InChI=1S/C12H22N2O8/c15-5-7-21-11(19)13-4-2-1-3-9(10(17)18)14-12(20)22-8-6-16/h9,15-16H,1-8H2,(H,13,19)(H,14,20)(H,17,18) |
| InChIKey | MWEKTNLCVVQBGL-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|