ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate

C16H32N4O6 — CID 126603912

IUPACethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate
SMILESCCOC(=O)C(CCCCNC(=O)OCCCN)NC(=O)OCCCN
InChIInChI=1S/C16H32N4O6/c1-2-24-14(21)13(20-16(23)26-12-6-9-18)7-3-4-10-19-15(22)25-11-5-8-17/h13H,2-12,17-18H2,1H3,(H,19,22)(H,20,23)
InChIKeyYHYSNOVSDIYWHZ-UHFFFAOYSA-N
MW376.45 g/mol
LogP0.24
Rot. Bonds14

About ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate

ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate (PubChem CID 126603912) has the molecular formula C16H32N4O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate.

Molecular Properties

Compound Nameethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate
PubChem CID126603912
Molecular FormulaC16H32N4O6
Molecular Weight376.45 g/mol
Exact Mass376.23
IUPAC Nameethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate
SMILESCCOC(=O)C(CCCCNC(=O)OCCCN)NC(=O)OCCCN
InChIInChI=1S/C16H32N4O6/c1-2-24-14(21)13(20-16(23)26-12-6-9-18)7-3-4-10-19-15(22)25-11-5-8-17/h13H,2-12,17-18H2,1H3,(H,19,22)(H,20,23)
InChIKeyYHYSNOVSDIYWHZ-UHFFFAOYSA-N
XLogP0.24
TPSA155.00 Ų
H-Bond Donors4
H-Bond Acceptors8
Rotatable Bonds14
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.45
LogP ≤ 50.24
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate?
The IUPAC name of ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate (CID 126603912) is ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate.
What is the SMILES notation for ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate?
The canonical SMILES for ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate is CCOC(=O)C(CCCCNC(=O)OCCCN)NC(=O)OCCCN.
What is the InChIKey of ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate?
The InChIKey is YHYSNOVSDIYWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4O6/c1-2-24-14(21)13(20-16(23)26-12-6-9-18)7-3-4-10-19-15(22)25-11-5-8-17/h13H,2-12,17-18H2,1H3,(H,19,22)(H,20,23).
What are the key properties of ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate?
ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate has a molecular weight of 376.45 g/mol, XLogP of 0.24, 14 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate is sourced from PubChem (CID 126603912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).