C16H32N4O6 — CID 126603912
ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate (PubChem CID 126603912) has the molecular formula C16H32N4O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate.
| Compound Name | ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 126603912 |
| Molecular Formula | C16H32N4O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | ethyl 2,6-bis(3-aminopropoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)C(CCCCNC(=O)OCCCN)NC(=O)OCCCN |
| InChI | InChI=1S/C16H32N4O6/c1-2-24-14(21)13(20-16(23)26-12-6-9-18)7-3-4-10-19-15(22)25-11-5-8-17/h13H,2-12,17-18H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | YHYSNOVSDIYWHZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|