C13H25N3O6 — CID 121420951
methylamino 2,6-bis(ethoxycarbonylamino)hexanoate (PubChem CID 121420951) has the molecular formula C13H25N3O6 and a molecular weight of 319.36 g/mol. Its IUPAC name is methylamino 2,6-bis(ethoxycarbonylamino)hexanoate.
| Compound Name | methylamino 2,6-bis(ethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 121420951 |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | methylamino 2,6-bis(ethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)ONC |
| InChI | InChI=1S/C13H25N3O6/c1-4-20-12(18)15-9-7-6-8-10(11(17)22-14-3)16-13(19)21-5-2/h10,14H,4-9H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | GNYFFDNHIYJCKQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|