About ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane
ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane (PubChem CID 163834856) has the molecular formula C14H28IN3O6
and a molecular weight of 461.30 g/mol. Its IUPAC name is ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane.
Molecular Properties
| Compound Name | ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane |
| PubChem CID | 163834856 |
| Molecular Formula | C14H28IN3O6 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)CON.CI |
| InChI | InChI=1S/C13H25N3O6.CH3I/c1-3-20-12(18)15-8-6-5-7-10(11(17)9-22-14)16-13(19)21-4-2;1-2/h10H,3-9,14H2,1-2H3,(H,15,18)(H,16,19);1H3 |
| InChIKey | OGWLUWLONUUUGP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane?
The IUPAC name of ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane (CID 163834856) is ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane.
What is the SMILES notation for ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane?
The canonical SMILES for ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane is CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)CON.CI.
What is the InChIKey of ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane?
The InChIKey is OGWLUWLONUUUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O6.CH3I/c1-3-20-12(18)15-8-6-5-7-10(11(17)9-22-14)16-13(19)21-4-2;1-2/h10H,3-9,14H2,1-2H3,(H,15,18)(H,16,19);1H3.
What are the key properties of ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane?
ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane has a molecular weight of 461.30 g/mol, XLogP of 1.53, 11 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-aminooxy-7-(ethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate;iodomethane is sourced from PubChem (CID 163834856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).