C24H43N3O10 — CID 90701699
ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-[2-(4-oxobutoxy)ethylamino]hexan-2-yl]carbamate;formaldehyde;pentanedial (PubChem CID 90701699) has the molecular formula C24H43N3O10 and a molecular weight of 533.62 g/mol. Its IUPAC name is ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-[2-(4-oxobutoxy)ethylamino]hexan-2-yl]carbamate;formaldehyde;pentanedial.
| Compound Name | ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-[2-(4-oxobutoxy)ethylamino]hexan-2-yl]carbamate;formaldehyde;pentanedial |
|---|---|
| PubChem CID | 90701699 |
| Molecular Formula | C24H43N3O10 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-[2-(4-oxobutoxy)ethylamino]hexan-2-yl]carbamate;formaldehyde;pentanedial |
| SMILES | C=O.CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)NCCOCCCC=O.O=CCCCC=O |
| InChI | InChI=1S/C18H33N3O7.C5H8O2.CH2O/c1-3-27-17(24)20-10-6-5-9-15(21-18(25)28-4-2)16(23)19-11-14-26-13-8-7-12-22;6-4-2-1-3-5-7;1-2/h12,15H,3-11,13-14H2,1-2H3,(H,19,23)(H,20,24)(H,21,25);4-5H,1-3H2;1H2 |
| InChIKey | OVCRKHKGSUSRTG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 183.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|