C30H50N6O14 — CID 160808302
(2,5-dioxopyrrolidin-1-yl) 2,6-bis(ethoxycarbonylamino)hexanoate;ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-(2-oxoethylamino)hexan-2-yl]carbamate (PubChem CID 160808302) has the molecular formula C30H50N6O14 and a molecular weight of 718.76 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,6-bis(ethoxycarbonylamino)hexanoate;ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-(2-oxoethylamino)hexan-2-yl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis(ethoxycarbonylamino)hexanoate;ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-(2-oxoethylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 160808302 |
| Molecular Formula | C30H50N6O14 |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis(ethoxycarbonylamino)hexanoate;ethyl N-[6-(ethoxycarbonylamino)-1-oxo-1-(2-oxoethylamino)hexan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)NCC=O.CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H25N3O8.C14H25N3O6/c1-3-25-15(23)17-10-6-5-7-11(18-16(24)26-4-2)14(22)27-19-12(20)8-9-13(19)21;1-3-22-13(20)16-8-6-5-7-11(12(19)15-9-10-18)17-14(21)23-4-2/h11H,3-10H2,1-2H3,(H,17,23)(H,18,24);10-11H,3-9H2,1-2H3,(H,15,19)(H,16,20)(H,17,21) |
| InChIKey | SDZGNRNFSYGULT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 263.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|