C21H36N6O9S — CID 58340977
ethyl N-[1-[2-[3-[2,5-dioxo-3-(tritiosulfanyloxyamino)pyrrolidin-1-yl]propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58340977) has the molecular formula C21H36N6O9S and a molecular weight of 550.63 g/mol. Its IUPAC name is ethyl N-[1-[2-[3-[2,5-dioxo-3-(tritiosulfanyloxyamino)pyrrolidin-1-yl]propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[2-[3-[2,5-dioxo-3-(tritiosulfanyloxyamino)pyrrolidin-1-yl]propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58340977 |
| Molecular Formula | C21H36N6O9S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | ethyl N-[1-[2-[3-[2,5-dioxo-3-(tritiosulfanyloxyamino)pyrrolidin-1-yl]propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | [3H]SONC1CC(=O)N(CCC(=O)NCCNC(=O)C(CCCCNC(=O)OCC)NC(=O)OCC)C1=O |
| InChI | InChI=1S/C21H36N6O9S/c1-3-34-20(32)24-9-6-5-7-14(25-21(33)35-4-2)18(30)23-11-10-22-16(28)8-12-27-17(29)13-15(19(27)31)26-36-37/h14-15,26,37H,3-13H2,1-2H3,(H,22,28)(H,23,30)(H,24,32)(H,25,33)/i/hT |
| InChIKey | WOFZZRJRSLBAIZ-MNYXATJNSA-N |
| XLogP | -0.87 |
| TPSA | 193.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|