C21H33N5O8 — CID 58841250
ethyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58841250) has the molecular formula C21H33N5O8 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58841250 |
| Molecular Formula | C21H33N5O8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | ethyl N-[1-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H33N5O8/c1-3-33-20(31)24-11-6-5-7-15(25-21(32)34-4-2)19(30)23-13-12-22-16(27)10-14-26-17(28)8-9-18(26)29/h8-9,15H,3-7,10-14H2,1-2H3,(H,22,27)(H,23,30)(H,24,31)(H,25,32) |
| InChIKey | FHTISJWBOKXDDC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|