C15H23N3O4 — CID 58587501
3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide (PubChem CID 58587501) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide |
|---|---|
| PubChem CID | 58587501 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide |
| SMILES | CN[C@@H](CCCCNC(=O)CCN1C(=O)C=CC1=O)C(C)=O |
| InChI | InChI=1S/C15H23N3O4/c1-11(19)12(16-2)5-3-4-9-17-13(20)8-10-18-14(21)6-7-15(18)22/h6-7,12,16H,3-5,8-10H2,1-2H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | PFOHGAGJZGLSNQ-LBPRGKRZSA-N |
| XLogP | -0.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|