C16H23N5O6 — CID 171818132
N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 171818132) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 171818132 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CC(=O)C(CCCNC(N)=O)NC(=O)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H23N5O6/c1-10(22)11(3-2-7-18-16(17)27)20-13(24)9-19-12(23)6-8-21-14(25)4-5-15(21)26/h4-5,11H,2-3,6-9H2,1H3,(H,19,23)(H,20,24)(H3,17,18,27) |
| InChIKey | VQERUWKBESGHND-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|