C20H28N6O9 — CID 174291535
[[2-[[2-[[2-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methyl acetate (PubChem CID 174291535) has the molecular formula C20H28N6O9 and a molecular weight of 496.48 g/mol. Its IUPAC name is [[2-[[2-[[2-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methyl acetate.
| Compound Name | [[2-[[2-[[2-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methyl acetate |
|---|---|
| PubChem CID | 174291535 |
| Molecular Formula | C20H28N6O9 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [[2-[[2-[[2-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methyl acetate |
| SMILES | CC(=O)OCNC(=O)CNC(=O)CNC(=O)CNC(=O)CCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H28N6O9/c1-13(27)35-12-25-18(32)11-24-17(31)10-23-16(30)9-22-14(28)3-2-7-21-15(29)6-8-26-19(33)4-5-20(26)34/h4-5H,2-3,6-12H2,1H3,(H,21,29)(H,22,28)(H,23,30)(H,24,31)(H,25,32) |
| InChIKey | POKXASPFYVNRBO-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 209.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|