C13H22N2O4 — CID 158981138
3-(2,5-dioxopyrrol-1-yl)-N-(4-methoxybutyl)propanamide;methane (PubChem CID 158981138) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(4-methoxybutyl)propanamide;methane.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(4-methoxybutyl)propanamide;methane |
|---|---|
| PubChem CID | 158981138 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(4-methoxybutyl)propanamide;methane |
| SMILES | C.COCCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H18N2O4.CH4/c1-18-9-3-2-7-13-10(15)6-8-14-11(16)4-5-12(14)17;/h4-5H,2-3,6-9H2,1H3,(H,13,15);1H4 |
| InChIKey | JPACCSSIMBGOIP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|